About magnesium;1-chloro-2-methylhexane;hydride
magnesium;1-chloro-2-methylhexane;hydride (PubChem CID 173396066) has the molecular formula C7H17ClMg
and a molecular weight of 160.97 g/mol. Its IUPAC name is magnesium;1-chloro-2-methylhexane;hydride.
Molecular Properties
| Compound Name | magnesium;1-chloro-2-methylhexane;hydride |
| PubChem CID | 173396066 |
| Molecular Formula | C7H17ClMg |
| Molecular Weight | 160.97 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | magnesium;1-chloro-2-methylhexane;hydride |
| SMILES | CCCCC(C)CCl.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C7H15Cl.Mg.2H/c1-3-4-5-7(2)6-8;;;/h7H,3-6H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | KLVDNHVTJPGCKA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.97 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1-chloro-2-methylhexane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1-chloro-2-methylhexane;hydride?
The IUPAC name of magnesium;1-chloro-2-methylhexane;hydride (CID 173396066) is magnesium;1-chloro-2-methylhexane;hydride.
What is the SMILES notation for magnesium;1-chloro-2-methylhexane;hydride?
The canonical SMILES for magnesium;1-chloro-2-methylhexane;hydride is CCCCC(C)CCl.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;1-chloro-2-methylhexane;hydride?
The InChIKey is KLVDNHVTJPGCKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15Cl.Mg.2H/c1-3-4-5-7(2)6-8;;;/h7H,3-6H2,1-2H3;;;/q;+2;2*-1.
What are the key properties of magnesium;1-chloro-2-methylhexane;hydride?
magnesium;1-chloro-2-methylhexane;hydride has a molecular weight of 160.97 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1-chloro-2-methylhexane;hydride is sourced from PubChem (CID 173396066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).