C19H40O5P+ — CID 101003842
[(2R)-2,3-dioctoxypropoxy]-hydroxy-oxophosphanium (PubChem CID 101003842) has the molecular formula C19H40O5P+ and a molecular weight of 379.50 g/mol. Its IUPAC name is [(2R)-2,3-dioctoxypropoxy]-hydroxy-oxophosphanium.
| Compound Name | [(2R)-2,3-dioctoxypropoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 101003842 |
| Molecular Formula | C19H40O5P+ |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | [(2R)-2,3-dioctoxypropoxy]-hydroxy-oxophosphanium |
| SMILES | CCCCCCCCOC[C@H](CO[P+](=O)O)OCCCCCCCC |
| InChI | InChI=1S/C19H39O5P/c1-3-5-7-9-11-13-15-22-17-19(18-24-25(20)21)23-16-14-12-10-8-6-4-2/h19H,3-18H2,1-2H3/p+1/t19-/m1/s1 |
| InChIKey | OKOQLWMMWUUMNO-LJQANCHMSA-O |
| XLogP | 5.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|