About (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine
(2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine (PubChem CID 15590424) has the molecular formula C5H14ClNO3P+
and a molecular weight of 202.60 g/mol. Its IUPAC name is (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine.
Molecular Properties
| Compound Name | (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine |
| PubChem CID | 15590424 |
| Molecular Formula | C5H14ClNO3P+ |
| Molecular Weight | 202.60 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine |
| SMILES | CC(C)N.O=[P+](O)C(O)CCl |
| InChI | InChI=1S/C3H9N.C2H4ClO3P/c1-3(2)4;3-1-2(4)7(5)6/h3H,4H2,1-2H3;2,4H,1H2/p+1 |
| InChIKey | WFDOTDDOHYBKHW-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.60 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine?
The IUPAC name of (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine (CID 15590424) is (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine.
What is the SMILES notation for (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine?
The canonical SMILES for (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine is CC(C)N.O=[P+](O)C(O)CCl.
What is the InChIKey of (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine?
The InChIKey is WFDOTDDOHYBKHW-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H9N.C2H4ClO3P/c1-3(2)4;3-1-2(4)7(5)6/h3H,4H2,1-2H3;2,4H,1H2/p+1.
What are the key properties of (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine?
(2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine has a molecular weight of 202.60 g/mol, XLogP of 0.63, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-1-hydroxyethyl)-hydroxy-oxophosphanium;propan-2-amine is sourced from PubChem (CID 15590424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).