C4H10ClNO — CID 154700575
(2R,3S)-3-amino-1-chlorobutan-2-ol (PubChem CID 154700575) has the molecular formula C4H10ClNO and a molecular weight of 123.58 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-chlorobutan-2-ol.
| Compound Name | (2R,3S)-3-amino-1-chlorobutan-2-ol |
|---|---|
| PubChem CID | 154700575 |
| Molecular Formula | C4H10ClNO |
| Molecular Weight | 123.58 g/mol |
| Exact Mass | 123.05 |
| IUPAC Name | (2R,3S)-3-amino-1-chlorobutan-2-ol |
| SMILES | C[C@H](N)[C@@H](O)CCl |
| InChI | InChI=1S/C4H10ClNO/c1-3(6)4(7)2-5/h3-4,7H,2,6H2,1H3/t3-,4-/m0/s1 |
| InChIKey | FOPDWNYRGFVVRV-IMJSIDKUSA-N |
| XLogP | -0.07 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.58 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|