C6H15N5O2 — CID 24961549
acetic acid;3-(diaminomethylidene)-1,1-dimethylguanidine (PubChem CID 24961549) has the molecular formula C6H15N5O2 and a molecular weight of 189.22 g/mol. Its IUPAC name is acetic acid;3-(diaminomethylidene)-1,1-dimethylguanidine.
| Compound Name | acetic acid;3-(diaminomethylidene)-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 24961549 |
| Molecular Formula | C6H15N5O2 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | acetic acid;3-(diaminomethylidene)-1,1-dimethylguanidine |
| SMILES | CC(=O)O.[H]/N=C(/N=C(N)N)N(C)C |
| InChI | InChI=1S/C4H11N5.C2H4O2/c1-9(2)4(7)8-3(5)6;1-2(3)4/h1-2H3,(H5,5,6,7,8);1H3,(H,3,4) |
| InChIKey | XADBMQVCRHIWQV-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|