About acetic acid;N-(diaminomethylidene)acetamide;zirconium
acetic acid;N-(diaminomethylidene)acetamide;zirconium (PubChem CID 174956391) has the molecular formula C5H11N3O3Zr
and a molecular weight of 252.38 g/mol. Its IUPAC name is acetic acid;N-(diaminomethylidene)acetamide;zirconium.
Molecular Properties
| Compound Name | acetic acid;N-(diaminomethylidene)acetamide;zirconium |
| PubChem CID | 174956391 |
| Molecular Formula | C5H11N3O3Zr |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | acetic acid;N-(diaminomethylidene)acetamide;zirconium |
| SMILES | CC(=O)N=C(N)N.CC(=O)O.[Zr] |
| InChI | InChI=1S/C3H7N3O.C2H4O2.Zr/c1-2(7)6-3(4)5;1-2(3)4;/h1H3,(H4,4,5,6,7);1H3,(H,3,4); |
| InChIKey | RLDFXZNGNSDWHU-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;N-(diaminomethylidene)acetamide;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;N-(diaminomethylidene)acetamide;zirconium?
The IUPAC name of acetic acid;N-(diaminomethylidene)acetamide;zirconium (CID 174956391) is acetic acid;N-(diaminomethylidene)acetamide;zirconium.
What is the SMILES notation for acetic acid;N-(diaminomethylidene)acetamide;zirconium?
The canonical SMILES for acetic acid;N-(diaminomethylidene)acetamide;zirconium is CC(=O)N=C(N)N.CC(=O)O.[Zr].
What is the InChIKey of acetic acid;N-(diaminomethylidene)acetamide;zirconium?
The InChIKey is RLDFXZNGNSDWHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N3O.C2H4O2.Zr/c1-2(7)6-3(4)5;1-2(3)4;/h1H3,(H4,4,5,6,7);1H3,(H,3,4);.
What are the key properties of acetic acid;N-(diaminomethylidene)acetamide;zirconium?
acetic acid;N-(diaminomethylidene)acetamide;zirconium has a molecular weight of 252.38 g/mol, XLogP of -1.11, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;N-(diaminomethylidene)acetamide;zirconium is sourced from PubChem (CID 174956391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).