C6H13N5 — CID 161367334
3-[amino-(ethylideneamino)methylidene]-1,1-dimethylguanidine (PubChem CID 161367334) has the molecular formula C6H13N5 and a molecular weight of 155.21 g/mol. Its IUPAC name is 3-[amino-(ethylideneamino)methylidene]-1,1-dimethylguanidine.
| Compound Name | 3-[amino-(ethylideneamino)methylidene]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 161367334 |
| Molecular Formula | C6H13N5 |
| Molecular Weight | 155.21 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | 3-[amino-(ethylideneamino)methylidene]-1,1-dimethylguanidine |
| SMILES | [H]/N=C(/N=C(N)N=CC)N(C)C |
| InChI | InChI=1S/C6H13N5/c1-4-9-5(7)10-6(8)11(2)3/h4H,1-3H3,(H3,7,8,10) |
| InChIKey | CUFKKPBXUZJZHA-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|