About 3-ethylidene-1,1-bis(4-methylphenyl)guanidine
3-ethylidene-1,1-bis(4-methylphenyl)guanidine (PubChem CID 57050474) has the molecular formula C17H19N3
and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-ethylidene-1,1-bis(4-methylphenyl)guanidine.
Molecular Properties
| Compound Name | 3-ethylidene-1,1-bis(4-methylphenyl)guanidine |
| PubChem CID | 57050474 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 3-ethylidene-1,1-bis(4-methylphenyl)guanidine |
| SMILES | [H]/N=C(\N=CC)N(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H19N3/c1-4-19-17(18)20(15-9-5-13(2)6-10-15)16-11-7-14(3)8-12-16/h4-12,18H,1-3H3/b18-17+,19-4? |
| InChIKey | ZGSBDEBBWPHUFF-VTICOHSMSA-N |
| XLogP | 4.47 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylidene-1,1-bis(4-methylphenyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylidene-1,1-bis(4-methylphenyl)guanidine?
The IUPAC name of 3-ethylidene-1,1-bis(4-methylphenyl)guanidine (CID 57050474) is 3-ethylidene-1,1-bis(4-methylphenyl)guanidine.
What is the SMILES notation for 3-ethylidene-1,1-bis(4-methylphenyl)guanidine?
The canonical SMILES for 3-ethylidene-1,1-bis(4-methylphenyl)guanidine is [H]/N=C(\N=CC)N(c1ccc(C)cc1)c1ccc(C)cc1.
What is the InChIKey of 3-ethylidene-1,1-bis(4-methylphenyl)guanidine?
The InChIKey is ZGSBDEBBWPHUFF-VTICOHSMSA-N. The full InChI is InChI=1S/C17H19N3/c1-4-19-17(18)20(15-9-5-13(2)6-10-15)16-11-7-14(3)8-12-16/h4-12,18H,1-3H3/b18-17+,19-4?.
What are the key properties of 3-ethylidene-1,1-bis(4-methylphenyl)guanidine?
3-ethylidene-1,1-bis(4-methylphenyl)guanidine has a molecular weight of 265.36 g/mol, XLogP of 4.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylidene-1,1-bis(4-methylphenyl)guanidine is sourced from PubChem (CID 57050474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).