C33H30N4 — CID 89400085
4-N-(4-diazenylphenyl)-1-N,1-N,4-N-tris(4-methylphenyl)benzene-1,4-diamine (PubChem CID 89400085) has the molecular formula C33H30N4 and a molecular weight of 482.63 g/mol. Its IUPAC name is 4-N-(4-diazenylphenyl)-1-N,1-N,4-N-tris(4-methylphenyl)benzene-1,4-diamine.
| Compound Name | 4-N-(4-diazenylphenyl)-1-N,1-N,4-N-tris(4-methylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 89400085 |
| Molecular Formula | C33H30N4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 4-N-(4-diazenylphenyl)-1-N,1-N,4-N-tris(4-methylphenyl)benzene-1,4-diamine |
| SMILES | [H]/N=N/c1ccc(N(c2ccc(C)cc2)c2ccc(N(c3ccc(C)cc3)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H30N4/c1-24-4-12-28(13-5-24)36(29-14-6-25(2)7-15-29)32-20-22-33(23-21-32)37(30-16-8-26(3)9-17-30)31-18-10-27(35-34)11-19-31/h4-23,34H,1-3H3/b35-34+ |
| InChIKey | RQPCRKVFEYJQNC-XAHDOWKMSA-N |
| XLogP | 10.21 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|