C33H33NO2 — CID 70600913
4-methyl-N,N-bis(4-methylphenyl)aniline;phenol (PubChem CID 70600913) has the molecular formula C33H33NO2 and a molecular weight of 475.63 g/mol. Its IUPAC name is 4-methyl-N,N-bis(4-methylphenyl)aniline;phenol.
| Compound Name | 4-methyl-N,N-bis(4-methylphenyl)aniline;phenol |
|---|---|
| PubChem CID | 70600913 |
| Molecular Formula | C33H33NO2 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 4-methyl-N,N-bis(4-methylphenyl)aniline;phenol |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(C)cc2)cc1.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C21H21N.2C6H6O/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;2*7-6-4-2-1-3-5-6/h4-15H,1-3H3;2*1-5,7H |
| InChIKey | OZWHXLPYOBFVFL-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |