C21H23NO — CID 144899078
ethane;3-(N-(4-methylphenyl)anilino)phenol (PubChem CID 144899078) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is ethane;3-(N-(4-methylphenyl)anilino)phenol.
| Compound Name | ethane;3-(N-(4-methylphenyl)anilino)phenol |
|---|---|
| PubChem CID | 144899078 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | ethane;3-(N-(4-methylphenyl)anilino)phenol |
| SMILES | CC.Cc1ccc(N(c2ccccc2)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C19H17NO.C2H6/c1-15-10-12-17(13-11-15)20(16-6-3-2-4-7-16)18-8-5-9-19(21)14-18;1-2/h2-14,21H,1H3;1-2H3 |
| InChIKey | JXFCBLJUFJINCR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |