About N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide
N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide (PubChem CID 177429251) has the molecular formula C11H15N5O2
and a molecular weight of 249.27 g/mol. Its IUPAC name is N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide.
Molecular Properties
| Compound Name | N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide |
| PubChem CID | 177429251 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide |
| SMILES | [H]/N=C(/N=C(\N)NC(=O)c1ccccc1O)N(C)C |
| InChI | InChI=1S/C11H15N5O2/c1-16(2)11(13)15-10(12)14-9(18)7-5-3-4-6-8(7)17/h3-6,17H,1-2H3,(H4,12,13,14,15,18) |
| InChIKey | LIQVKTLUGOXUMQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide?
The IUPAC name of N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide (CID 177429251) is N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide.
What is the SMILES notation for N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide?
The canonical SMILES for N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide is [H]/N=C(/N=C(\N)NC(=O)c1ccccc1O)N(C)C.
What is the InChIKey of N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide?
The InChIKey is LIQVKTLUGOXUMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O2/c1-16(2)11(13)15-10(12)14-9(18)7-5-3-4-6-8(7)17/h3-6,17H,1-2H3,(H4,12,13,14,15,18).
What are the key properties of N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide?
N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide has a molecular weight of 249.27 g/mol, XLogP of -0.07, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-N'-(N,N-dimethylcarbamimidoyl)carbamimidoyl]-2-hydroxybenzamide is sourced from PubChem (CID 177429251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).