About 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide
2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide (PubChem CID 19854250) has the molecular formula C15H14N2O4
and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide.
Molecular Properties
| Compound Name | 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide |
| PubChem CID | 19854250 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide |
| SMILES | CN(NC(=O)c1ccccc1O)C(=O)c1ccccc1O |
| InChI | InChI=1S/C15H14N2O4/c1-17(15(21)11-7-3-5-9-13(11)19)16-14(20)10-6-2-4-8-12(10)18/h2-9,18-19H,1H3,(H,16,20) |
| InChIKey | XIEMGQNPHGGFAS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide?
The IUPAC name of 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide (CID 19854250) is 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide.
What is the SMILES notation for 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide?
The canonical SMILES for 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide is CN(NC(=O)c1ccccc1O)C(=O)c1ccccc1O.
What is the InChIKey of 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide?
The InChIKey is XIEMGQNPHGGFAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O4/c1-17(15(21)11-7-3-5-9-13(11)19)16-14(20)10-6-2-4-8-12(10)18/h2-9,18-19H,1H3,(H,16,20).
What are the key properties of 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide?
2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide has a molecular weight of 286.29 g/mol, XLogP of 1.51, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N'-(2-hydroxybenzoyl)-N'-methylbenzohydrazide is sourced from PubChem (CID 19854250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).