C9H13NO3 — CID 91440405
N,2-dihydroxybenzamide;ethane (PubChem CID 91440405) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is N,2-dihydroxybenzamide;ethane.
| Compound Name | N,2-dihydroxybenzamide;ethane |
|---|---|
| PubChem CID | 91440405 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | N,2-dihydroxybenzamide;ethane |
| SMILES | CC.O=C(NO)c1ccccc1O |
| InChI | InChI=1S/C7H7NO3.C2H6/c9-6-4-2-1-3-5(6)7(10)8-11;1-2/h1-4,9,11H,(H,8,10);1-2H3 |
| InChIKey | CAQUKHGQRVKPAD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|