C11H13N3O4 — CID 87823173
[2-[carbamimidoyl(methyl)amino]acetyl] 2-hydroxybenzoate (PubChem CID 87823173) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is [2-[carbamimidoyl(methyl)amino]acetyl] 2-hydroxybenzoate.
| Compound Name | [2-[carbamimidoyl(methyl)amino]acetyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 87823173 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [2-[carbamimidoyl(methyl)amino]acetyl] 2-hydroxybenzoate |
| SMILES | [H]/N=C(\N)N(C)CC(=O)OC(=O)c1ccccc1O |
| InChI | InChI=1S/C11H13N3O4/c1-14(11(12)13)6-9(16)18-10(17)7-4-2-3-5-8(7)15/h2-5,15H,6H2,1H3,(H3,12,13) |
| InChIKey | IZPWDHIXNPYQMW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|