About 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine
3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine (PubChem CID 91885566) has the molecular formula C23H46N6
and a molecular weight of 406.66 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine.
Molecular Properties
| Compound Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine |
| PubChem CID | 91885566 |
| Molecular Formula | C23H46N6 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.38 |
| IUPAC Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine |
| SMILES | C1CCC(C(CC2CCCCN2)C2CCCCC2)CC1.[H]/N=C(/N=C(N)N)N(C)C |
| InChI | InChI=1S/C19H35N.C4H11N5/c1-3-9-16(10-4-1)19(17-11-5-2-6-12-17)15-18-13-7-8-14-20-18;1-9(2)4(7)8-3(5)6/h16-20H,1-15H2;1-2H3,(H5,5,6,7,8) |
| InChIKey | PJXCRFHKHNYYQE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine?
The IUPAC name of 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine (CID 91885566) is 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine.
What is the SMILES notation for 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine?
The canonical SMILES for 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine is C1CCC(C(CC2CCCCN2)C2CCCCC2)CC1.[H]/N=C(/N=C(N)N)N(C)C.
What is the InChIKey of 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine?
The InChIKey is PJXCRFHKHNYYQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35N.C4H11N5/c1-3-9-16(10-4-1)19(17-11-5-2-6-12-17)15-18-13-7-8-14-20-18;1-9(2)4(7)8-3(5)6/h16-20H,1-15H2;1-2H3,(H5,5,6,7,8).
What are the key properties of 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine?
3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine has a molecular weight of 406.66 g/mol, XLogP of 4.05, 4 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine is sourced from PubChem (CID 91885566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).