C23H46N6 — CID 91885566
3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine (PubChem CID 91885566) has the molecular formula C23H46N6 and a molecular weight of 406.66 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine.
| Compound Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine |
|---|---|
| PubChem CID | 91885566 |
| Molecular Formula | C23H46N6 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.38 |
| IUPAC Name | 3-(diaminomethylidene)-1,1-dimethylguanidine;2-(2,2-dicyclohexylethyl)piperidine |
| SMILES | C1CCC(C(CC2CCCCN2)C2CCCCC2)CC1.[H]/N=C(/N=C(N)N)N(C)C |
| InChI | InChI=1S/C19H35N.C4H11N5/c1-3-9-16(10-4-1)19(17-11-5-2-6-12-17)15-18-13-7-8-14-20-18;1-9(2)4(7)8-3(5)6/h16-20H,1-15H2;1-2H3,(H5,5,6,7,8) |
| InChIKey | PJXCRFHKHNYYQE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|