C19H36ClN — CID 71369675
2-(2,2-dicyclohexylethyl)piperidine;hydrochloride (PubChem CID 71369675) has the molecular formula C19H36ClN and a molecular weight of 313.96 g/mol. Its IUPAC name is 2-(2,2-dicyclohexylethyl)piperidine;hydrochloride.
| Compound Name | 2-(2,2-dicyclohexylethyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 71369675 |
| Molecular Formula | C19H36ClN |
| Molecular Weight | 313.96 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 2-(2,2-dicyclohexylethyl)piperidine;hydrochloride |
| SMILES | C1CCC(C(CC2CCCCN2)C2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C19H35N.ClH/c1-3-9-16(10-4-1)19(17-11-5-2-6-12-17)15-18-13-7-8-14-20-18;/h16-20H,1-15H2;1H |
| InChIKey | IUISNHKIKKJZCK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.96 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |