C9H13N5O — CID 175345230
3-(diaminomethylidene)-1-(hydroxymethyl)-1-phenylguanidine (PubChem CID 175345230) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1-(hydroxymethyl)-1-phenylguanidine.
| Compound Name | 3-(diaminomethylidene)-1-(hydroxymethyl)-1-phenylguanidine |
|---|---|
| PubChem CID | 175345230 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3-(diaminomethylidene)-1-(hydroxymethyl)-1-phenylguanidine |
| SMILES | [H]/N=C(\N=C(N)N)N(CO)c1ccccc1 |
| InChI | InChI=1S/C9H13N5O/c10-8(11)13-9(12)14(6-15)7-4-2-1-3-5-7/h1-5,15H,6H2,(H5,10,11,12,13) |
| InChIKey | LITCVZHGLFUIHJ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|