C10H13ClF3N5 — CID 174865268
1-benzyl-3-(diaminomethylidene)-1-(trifluoromethyl)guanidine;hydrochloride (PubChem CID 174865268) has the molecular formula C10H13ClF3N5 and a molecular weight of 295.70 g/mol. Its IUPAC name is 1-benzyl-3-(diaminomethylidene)-1-(trifluoromethyl)guanidine;hydrochloride.
| Compound Name | 1-benzyl-3-(diaminomethylidene)-1-(trifluoromethyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 174865268 |
| Molecular Formula | C10H13ClF3N5 |
| Molecular Weight | 295.70 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 1-benzyl-3-(diaminomethylidene)-1-(trifluoromethyl)guanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(\N=C(N)N)N(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3N5.ClH/c11-10(12,13)18(9(16)17-8(14)15)6-7-4-2-1-3-5-7;/h1-5H,6H2,(H5,14,15,16,17);1H |
| InChIKey | BGVJEQYGODRLOG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.70 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|