C12H20N5O3P — CID 58600316
3-(diaminomethylidene)-1-dimethoxyphosphoryl-1-(2-phenylethyl)guanidine (PubChem CID 58600316) has the molecular formula C12H20N5O3P and a molecular weight of 313.30 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1-dimethoxyphosphoryl-1-(2-phenylethyl)guanidine.
| Compound Name | 3-(diaminomethylidene)-1-dimethoxyphosphoryl-1-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 58600316 |
| Molecular Formula | C12H20N5O3P |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3-(diaminomethylidene)-1-dimethoxyphosphoryl-1-(2-phenylethyl)guanidine |
| SMILES | [H]/N=C(\N=C(N)N)N(CCc1ccccc1)P(=O)(OC)OC |
| InChI | InChI=1S/C12H20N5O3P/c1-19-21(18,20-2)17(12(15)16-11(13)14)9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H5,13,14,15,16) |
| InChIKey | WSVVDGKGSPLLSH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|