C14H22N2 — CID 65487169
N,2,2-trimethyl-N-(2-phenylethyl)propanimidamide (PubChem CID 65487169) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N,2,2-trimethyl-N-(2-phenylethyl)propanimidamide.
| Compound Name | N,2,2-trimethyl-N-(2-phenylethyl)propanimidamide |
|---|---|
| PubChem CID | 65487169 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N,2,2-trimethyl-N-(2-phenylethyl)propanimidamide |
| SMILES | [H]/N=C(/N(C)CCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C14H22N2/c1-14(2,3)13(15)16(4)11-10-12-8-6-5-7-9-12/h5-9,15H,10-11H2,1-4H3/b15-13+ |
| InChIKey | PZVPQGMBPLATJN-FYWRMAATSA-N |
| XLogP | 3.18 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|