C10H16N10 — CID 174811284
1-[[amino-(diaminomethylideneamino)methylidene]amino]-3-(diaminomethylidene)-1-phenylguanidine (PubChem CID 174811284) has the molecular formula C10H16N10 and a molecular weight of 276.31 g/mol. Its IUPAC name is 1-[[amino-(diaminomethylideneamino)methylidene]amino]-3-(diaminomethylidene)-1-phenylguanidine.
| Compound Name | 1-[[amino-(diaminomethylideneamino)methylidene]amino]-3-(diaminomethylidene)-1-phenylguanidine |
|---|---|
| PubChem CID | 174811284 |
| Molecular Formula | C10H16N10 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-[[amino-(diaminomethylideneamino)methylidene]amino]-3-(diaminomethylidene)-1-phenylguanidine |
| SMILES | [H]/N=C(\N=C(N)N)N(N=C(N)N=C(N)N)c1ccccc1 |
| InChI | InChI=1S/C10H16N10/c11-7(12)17-9(15)19-20(10(16)18-8(13)14)6-4-2-1-3-5-6/h1-5H,(H5,13,14,16,18)(H6,11,12,15,17,19) |
| InChIKey | PDNRIYOVHPWYBO-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 194.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|