C15H16ClN5O3S — CID 175265499
(5-chloro-N-[N-(diaminomethylidene)carbamimidoyl]-2-methylanilino) benzenesulfonate (PubChem CID 175265499) has the molecular formula C15H16ClN5O3S and a molecular weight of 381.85 g/mol. Its IUPAC name is (5-chloro-N-[N-(diaminomethylidene)carbamimidoyl]-2-methylanilino) benzenesulfonate.
| Compound Name | (5-chloro-N-[N-(diaminomethylidene)carbamimidoyl]-2-methylanilino) benzenesulfonate |
|---|---|
| PubChem CID | 175265499 |
| Molecular Formula | C15H16ClN5O3S |
| Molecular Weight | 381.85 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | (5-chloro-N-[N-(diaminomethylidene)carbamimidoyl]-2-methylanilino) benzenesulfonate |
| SMILES | [H]/N=C(\N=C(N)N)N(OS(=O)(=O)c1ccccc1)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C15H16ClN5O3S/c1-10-7-8-11(16)9-13(10)21(15(19)20-14(17)18)24-25(22,23)12-5-3-2-4-6-12/h2-9H,1H3,(H5,17,18,19,20) |
| InChIKey | JUUOTFRZNSJTJT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.85 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|