C12H18Cl3N5 — CID 121003349
3-(diaminomethylidene)-1-[(2,4-dichlorophenyl)methyl]-1-propan-2-ylguanidine;hydrochloride (PubChem CID 121003349) has the molecular formula C12H18Cl3N5 and a molecular weight of 338.67 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1-[(2,4-dichlorophenyl)methyl]-1-propan-2-ylguanidine;hydrochloride.
| Compound Name | 3-(diaminomethylidene)-1-[(2,4-dichlorophenyl)methyl]-1-propan-2-ylguanidine;hydrochloride |
|---|---|
| PubChem CID | 121003349 |
| Molecular Formula | C12H18Cl3N5 |
| Molecular Weight | 338.67 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 3-(diaminomethylidene)-1-[(2,4-dichlorophenyl)methyl]-1-propan-2-ylguanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(\N=C(N)N)N(Cc1ccc(Cl)cc1Cl)C(C)C |
| InChI | InChI=1S/C12H17Cl2N5.ClH/c1-7(2)19(12(17)18-11(15)16)6-8-3-4-9(13)5-10(8)14;/h3-5,7H,6H2,1-2H3,(H5,15,16,17,18);1H |
| InChIKey | NVEWRFNTIXWUHB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.67 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|