C14H19Cl2N5O7 — CID 141120225
(2,4-dichloro-N-[N-(diaminomethylidene)carbamimidoyl]anilino) 2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 141120225) has the molecular formula C14H19Cl2N5O7 and a molecular weight of 440.24 g/mol. Its IUPAC name is (2,4-dichloro-N-[N-(diaminomethylidene)carbamimidoyl]anilino) 2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | (2,4-dichloro-N-[N-(diaminomethylidene)carbamimidoyl]anilino) 2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 141120225 |
| Molecular Formula | C14H19Cl2N5O7 |
| Molecular Weight | 440.24 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | (2,4-dichloro-N-[N-(diaminomethylidene)carbamimidoyl]anilino) 2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | [H]/N=C(\N=C(N)N)N(OC(=O)C(O)C(O)C(O)C(O)CO)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2N5O7/c15-5-1-2-7(6(16)3-5)21(14(19)20-13(17)18)28-12(27)11(26)10(25)9(24)8(23)4-22/h1-3,8-11,22-26H,4H2,(H5,17,18,19,20) |
| InChIKey | NUDQQYHPULOONN-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 218.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.24 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|