C9H10ClFN4O — CID 21161421
1-(4-chloro-2-fluorophenyl)-3-(diaminomethylidene)-1-methylurea (PubChem CID 21161421) has the molecular formula C9H10ClFN4O and a molecular weight of 244.66 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-(diaminomethylidene)-1-methylurea.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-(diaminomethylidene)-1-methylurea |
|---|---|
| PubChem CID | 21161421 |
| Molecular Formula | C9H10ClFN4O |
| Molecular Weight | 244.66 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-(diaminomethylidene)-1-methylurea |
| SMILES | CN(C(=O)N=C(N)N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C9H10ClFN4O/c1-15(9(16)14-8(12)13)7-3-2-5(10)4-6(7)11/h2-4H,1H3,(H4,12,13,14,16) |
| InChIKey | YKOSWTHZWFSKIO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.66 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|