C11H14ClFN4O — CID 23348994
1-(4-chloro-2-ethyl-6-fluorophenyl)-3-(diaminomethylidene)-1-methylurea (PubChem CID 23348994) has the molecular formula C11H14ClFN4O and a molecular weight of 272.71 g/mol. Its IUPAC name is 1-(4-chloro-2-ethyl-6-fluorophenyl)-3-(diaminomethylidene)-1-methylurea.
| Compound Name | 1-(4-chloro-2-ethyl-6-fluorophenyl)-3-(diaminomethylidene)-1-methylurea |
|---|---|
| PubChem CID | 23348994 |
| Molecular Formula | C11H14ClFN4O |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-(4-chloro-2-ethyl-6-fluorophenyl)-3-(diaminomethylidene)-1-methylurea |
| SMILES | CCc1cc(Cl)cc(F)c1N(C)C(=O)N=C(N)N |
| InChI | InChI=1S/C11H14ClFN4O/c1-3-6-4-7(12)5-8(13)9(6)17(2)11(18)16-10(14)15/h4-5H,3H2,1-2H3,(H4,14,15,16,18) |
| InChIKey | YHWRCACCKDPCFP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|