C11H14Cl2N4O — CID 54536582
1-carbamimidoyl-1-(2,4-dichloro-6-ethylphenyl)-3-methylurea (PubChem CID 54536582) has the molecular formula C11H14Cl2N4O and a molecular weight of 289.17 g/mol. Its IUPAC name is 1-carbamimidoyl-1-(2,4-dichloro-6-ethylphenyl)-3-methylurea.
| Compound Name | 1-carbamimidoyl-1-(2,4-dichloro-6-ethylphenyl)-3-methylurea |
|---|---|
| PubChem CID | 54536582 |
| Molecular Formula | C11H14Cl2N4O |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 1-carbamimidoyl-1-(2,4-dichloro-6-ethylphenyl)-3-methylurea |
| SMILES | [H]/N=C(\N)N(C(=O)NC)c1c(Cl)cc(Cl)cc1CC |
| InChI | InChI=1S/C11H14Cl2N4O/c1-3-6-4-7(12)5-8(13)9(6)17(10(14)15)11(18)16-2/h4-5H,3H2,1-2H3,(H3,14,15)(H,16,18) |
| InChIKey | ZAFBEQGQPXBBHL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|