C11H15Cl2N3 — CID 65317630
3-[(2,5-dichlorophenyl)methyl-methylamino]propanimidamide (PubChem CID 65317630) has the molecular formula C11H15Cl2N3 and a molecular weight of 260.17 g/mol. Its IUPAC name is 3-[(2,5-dichlorophenyl)methyl-methylamino]propanimidamide.
| Compound Name | 3-[(2,5-dichlorophenyl)methyl-methylamino]propanimidamide |
|---|---|
| PubChem CID | 65317630 |
| Molecular Formula | C11H15Cl2N3 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 3-[(2,5-dichlorophenyl)methyl-methylamino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(C)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H15Cl2N3/c1-16(5-4-11(14)15)7-8-6-9(12)2-3-10(8)13/h2-3,6H,4-5,7H2,1H3,(H3,14,15) |
| InChIKey | SILLYROKSMMOQQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|