C11H15F2N3 — CID 43658900
3-[(2,3-difluorophenyl)methyl-methylamino]propanimidamide (PubChem CID 43658900) has the molecular formula C11H15F2N3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-[(2,3-difluorophenyl)methyl-methylamino]propanimidamide.
| Compound Name | 3-[(2,3-difluorophenyl)methyl-methylamino]propanimidamide |
|---|---|
| PubChem CID | 43658900 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 3-[(2,3-difluorophenyl)methyl-methylamino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(C)Cc1cccc(F)c1F |
| InChI | InChI=1S/C11H15F2N3/c1-16(6-5-10(14)15)7-8-3-2-4-9(12)11(8)13/h2-4H,5-7H2,1H3,(H3,14,15) |
| InChIKey | LLETZIKRAJXCHX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|