C12H17N5 — CID 43186266
3-[imidazo[1,2-a]pyridin-2-ylmethyl(methyl)amino]propanimidamide (PubChem CID 43186266) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-[imidazo[1,2-a]pyridin-2-ylmethyl(methyl)amino]propanimidamide.
| Compound Name | 3-[imidazo[1,2-a]pyridin-2-ylmethyl(methyl)amino]propanimidamide |
|---|---|
| PubChem CID | 43186266 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 3-[imidazo[1,2-a]pyridin-2-ylmethyl(methyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(C)Cc1cn2ccccc2n1 |
| InChI | InChI=1S/C12H17N5/c1-16(7-5-11(13)14)8-10-9-17-6-3-2-4-12(17)15-10/h2-4,6,9H,5,7-8H2,1H3,(H3,13,14) |
| InChIKey | AUDYXHSTFWAZSC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|