C13H18N4S — CID 54992223
3-[imidazo[1,2-a]pyridin-2-ylmethyl(methyl)amino]-2-methylpropanethioamide (PubChem CID 54992223) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is 3-[imidazo[1,2-a]pyridin-2-ylmethyl(methyl)amino]-2-methylpropanethioamide.
| Compound Name | 3-[imidazo[1,2-a]pyridin-2-ylmethyl(methyl)amino]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 54992223 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-[imidazo[1,2-a]pyridin-2-ylmethyl(methyl)amino]-2-methylpropanethioamide |
| SMILES | CC(CN(C)Cc1cn2ccccc2n1)C(N)=S |
| InChI | InChI=1S/C13H18N4S/c1-10(13(14)18)7-16(2)8-11-9-17-6-4-3-5-12(17)15-11/h3-6,9-10H,7-8H2,1-2H3,(H2,14,18) |
| InChIKey | OHCZOHPSOLPWCM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|