C16H18N4 — CID 43458276
4-[[imidazo[1,2-a]pyridin-2-ylmethyl(methyl)amino]methyl]aniline (PubChem CID 43458276) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 4-[[imidazo[1,2-a]pyridin-2-ylmethyl(methyl)amino]methyl]aniline.
| Compound Name | 4-[[imidazo[1,2-a]pyridin-2-ylmethyl(methyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 43458276 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-[[imidazo[1,2-a]pyridin-2-ylmethyl(methyl)amino]methyl]aniline |
| SMILES | CN(Cc1ccc(N)cc1)Cc1cn2ccccc2n1 |
| InChI | InChI=1S/C16H18N4/c1-19(10-13-5-7-14(17)8-6-13)11-15-12-20-9-3-2-4-16(20)18-15/h2-9,12H,10-11,17H2,1H3 |
| InChIKey | DXVXHXVWDBBPED-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|