2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid

C12H15N3O2 — CID 54900006

IUPAC2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid
SMILESCCN(CC(=O)O)Cc1cn2ccccc2n1
InChIInChI=1S/C12H15N3O2/c1-2-14(9-12(16)17)7-10-8-15-6-4-3-5-11(15)13-10/h3-6,8H,2,7,9H2,1H3,(H,16,17)
InChIKeyPLASGJXYEDYIJS-UHFFFAOYSA-N
MW233.27 g/mol
LogP1.24
Rot. Bonds5

About 2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid

2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid (PubChem CID 54900006) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid
PubChem CID54900006
Molecular FormulaC12H15N3O2
Molecular Weight233.27 g/mol
Exact Mass233.12
IUPAC Name2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid
SMILESCCN(CC(=O)O)Cc1cn2ccccc2n1
InChIInChI=1S/C12H15N3O2/c1-2-14(9-12(16)17)7-10-8-15-6-4-3-5-11(15)13-10/h3-6,8H,2,7,9H2,1H3,(H,16,17)
InChIKeyPLASGJXYEDYIJS-UHFFFAOYSA-N
XLogP1.24
TPSA57.84 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.27
LogP ≤ 51.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid?
The IUPAC name of 2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid (CID 54900006) is 2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid.
What is the SMILES notation for 2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid?
The canonical SMILES for 2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid is CCN(CC(=O)O)Cc1cn2ccccc2n1.
What is the InChIKey of 2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid?
The InChIKey is PLASGJXYEDYIJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c1-2-14(9-12(16)17)7-10-8-15-6-4-3-5-11(15)13-10/h3-6,8H,2,7,9H2,1H3,(H,16,17).
What are the key properties of 2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid?
2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid has a molecular weight of 233.27 g/mol, XLogP of 1.24, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(imidazo[1,2-a]pyridin-2-ylmethyl)amino]acetic acid is sourced from PubChem (CID 54900006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).