About N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide
N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide (PubChem CID 3400889) has the molecular formula C24H22N6O
and a molecular weight of 410.48 g/mol. Its IUPAC name is N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide |
| PubChem CID | 3400889 |
| Molecular Formula | C24H22N6O |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N(Cc2cn3ccccc3n2)Cc2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H22N6O/c1-18(31)25-19-8-10-22(11-9-19)30(16-20-14-28-12-4-2-6-23(28)26-20)17-21-15-29-13-5-3-7-24(29)27-21/h2-15H,16-17H2,1H3,(H,25,31) |
| InChIKey | DOWLABOVTBFOPK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide?
The IUPAC name of N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide (CID 3400889) is N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide.
What is the SMILES notation for N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide?
The canonical SMILES for N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide is CC(=O)Nc1ccc(N(Cc2cn3ccccc3n2)Cc2cn3ccccc3n2)cc1.
What is the InChIKey of N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide?
The InChIKey is DOWLABOVTBFOPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N6O/c1-18(31)25-19-8-10-22(11-9-19)30(16-20-14-28-12-4-2-6-23(28)26-20)17-21-15-29-13-5-3-7-24(29)27-21/h2-15H,16-17H2,1H3,(H,25,31).
What are the key properties of N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide?
N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide has a molecular weight of 410.48 g/mol, XLogP of 4.15, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[bis(imidazo[1,2-a]pyridin-2-ylmethyl)amino]phenyl]acetamide is sourced from PubChem (CID 3400889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).