C15H14N4O — CID 24695598
2-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzenecarboximidamide (PubChem CID 24695598) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzenecarboximidamide.
| Compound Name | 2-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 24695598 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccccc1OCc1cn2ccccc2n1 |
| InChI | InChI=1S/C15H14N4O/c16-15(17)12-5-1-2-6-13(12)20-10-11-9-19-8-4-3-7-14(19)18-11/h1-9H,10H2,(H3,16,17) |
| InChIKey | CHARLBGNZBZFOF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|