C12H17BrN4O — CID 54221536
1-(2-bromo-6-propylphenyl)-1-carbamimidoyl-3-methylurea (PubChem CID 54221536) has the molecular formula C12H17BrN4O and a molecular weight of 313.20 g/mol. Its IUPAC name is 1-(2-bromo-6-propylphenyl)-1-carbamimidoyl-3-methylurea.
| Compound Name | 1-(2-bromo-6-propylphenyl)-1-carbamimidoyl-3-methylurea |
|---|---|
| PubChem CID | 54221536 |
| Molecular Formula | C12H17BrN4O |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1-(2-bromo-6-propylphenyl)-1-carbamimidoyl-3-methylurea |
| SMILES | [H]/N=C(\N)N(C(=O)NC)c1c(Br)cccc1CCC |
| InChI | InChI=1S/C12H17BrN4O/c1-3-5-8-6-4-7-9(13)10(8)17(11(14)15)12(18)16-2/h4,6-7H,3,5H2,1-2H3,(H3,14,15)(H,16,18) |
| InChIKey | QCXQSZWYQVHCTN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|