C16H23BrN4O — CID 173447145
1-(2-bromo-6-methylphenyl)-1-propyl-3-(pyrrolidine-1-carboximidoyl)urea (PubChem CID 173447145) has the molecular formula C16H23BrN4O and a molecular weight of 367.29 g/mol. Its IUPAC name is 1-(2-bromo-6-methylphenyl)-1-propyl-3-(pyrrolidine-1-carboximidoyl)urea.
| Compound Name | 1-(2-bromo-6-methylphenyl)-1-propyl-3-(pyrrolidine-1-carboximidoyl)urea |
|---|---|
| PubChem CID | 173447145 |
| Molecular Formula | C16H23BrN4O |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-(2-bromo-6-methylphenyl)-1-propyl-3-(pyrrolidine-1-carboximidoyl)urea |
| SMILES | [H]/N=C(/NC(=O)N(CCC)c1c(C)cccc1Br)N1CCCC1 |
| InChI | InChI=1S/C16H23BrN4O/c1-3-9-21(14-12(2)7-6-8-13(14)17)16(22)19-15(18)20-10-4-5-11-20/h6-8H,3-5,9-11H2,1-2H3,(H2,18,19,22) |
| InChIKey | HACBQFJHDDJPRZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|