C14H23ClN4O — CID 3052260
3-(diaminomethylidene)-1-(2,6-diethylphenyl)-1-ethylurea;hydrochloride (PubChem CID 3052260) has the molecular formula C14H23ClN4O and a molecular weight of 298.82 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1-(2,6-diethylphenyl)-1-ethylurea;hydrochloride.
| Compound Name | 3-(diaminomethylidene)-1-(2,6-diethylphenyl)-1-ethylurea;hydrochloride |
|---|---|
| PubChem CID | 3052260 |
| Molecular Formula | C14H23ClN4O |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 3-(diaminomethylidene)-1-(2,6-diethylphenyl)-1-ethylurea;hydrochloride |
| SMILES | CCc1cccc(CC)c1N(CC)C(=O)N=C(N)N.Cl |
| InChI | InChI=1S/C14H22N4O.ClH/c1-4-10-8-7-9-11(5-2)12(10)18(6-3)14(19)17-13(15)16;/h7-9H,4-6H2,1-3H3,(H4,15,16,17,19);1H |
| InChIKey | IHYHZYOHSMYZQS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|