C16H23NO4 — CID 165437646
[2-[2,6-diethyl-N-(methoxymethyl)anilino]-2-oxoethyl] acetate (PubChem CID 165437646) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is [2-[2,6-diethyl-N-(methoxymethyl)anilino]-2-oxoethyl] acetate.
| Compound Name | [2-[2,6-diethyl-N-(methoxymethyl)anilino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 165437646 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [2-[2,6-diethyl-N-(methoxymethyl)anilino]-2-oxoethyl] acetate |
| SMILES | CCc1cccc(CC)c1N(COC)C(=O)COC(C)=O |
| InChI | InChI=1S/C16H23NO4/c1-5-13-8-7-9-14(6-2)16(13)17(11-20-4)15(19)10-21-12(3)18/h7-9H,5-6,10-11H2,1-4H3 |
| InChIKey | GLGUQFKGIQZKCF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|