C24H31Cl2NO5 — CID 70292332
2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide;2-(4-chloro-2-methylphenoxy)propanoic acid (PubChem CID 70292332) has the molecular formula C24H31Cl2NO5 and a molecular weight of 484.42 g/mol. Its IUPAC name is 2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide;2-(4-chloro-2-methylphenoxy)propanoic acid.
| Compound Name | 2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide;2-(4-chloro-2-methylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 70292332 |
| Molecular Formula | C24H31Cl2NO5 |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide;2-(4-chloro-2-methylphenoxy)propanoic acid |
| SMILES | CCc1cccc(CC)c1N(COC)C(=O)CCl.Cc1cc(Cl)ccc1OC(C)C(=O)O |
| InChI | InChI=1S/C14H20ClNO2.C10H11ClO3/c1-4-11-7-6-8-12(5-2)14(11)16(10-18-3)13(17)9-15;1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h6-8H,4-5,9-10H2,1-3H3;3-5,7H,1-2H3,(H,12,13) |
| InChIKey | MBSZMCMKNAFFMH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|