C33H46Cl2N2O3 — CID 131720780
2-(4-benzylphenoxy)-N,N-diethylethanamine;2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide;hydrochloride (PubChem CID 131720780) has the molecular formula C33H46Cl2N2O3 and a molecular weight of 589.65 g/mol. Its IUPAC name is 2-(4-benzylphenoxy)-N,N-diethylethanamine;2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide;hydrochloride.
| Compound Name | 2-(4-benzylphenoxy)-N,N-diethylethanamine;2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 131720780 |
| Molecular Formula | C33H46Cl2N2O3 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | 2-(4-benzylphenoxy)-N,N-diethylethanamine;2-chloro-N-(2,6-diethylphenyl)-N-(methoxymethyl)acetamide;hydrochloride |
| SMILES | CCN(CC)CCOc1ccc(Cc2ccccc2)cc1.CCc1cccc(CC)c1N(COC)C(=O)CCl.Cl |
| InChI | InChI=1S/C19H25NO.C14H20ClNO2.ClH/c1-3-20(4-2)14-15-21-19-12-10-18(11-13-19)16-17-8-6-5-7-9-17;1-4-11-7-6-8-12(5-2)14(11)16(10-18-3)13(17)9-15;/h5-13H,3-4,14-16H2,1-2H3;6-8H,4-5,9-10H2,1-3H3;1H |
| InChIKey | ULJGAOQRNUNLLN-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|