C15H20Cl2N2O2 — CID 154317163
2-chloro-N-[(N-(2-chloroacetyl)-2,6-diethylanilino)methyl]acetamide (PubChem CID 154317163) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 2-chloro-N-[(N-(2-chloroacetyl)-2,6-diethylanilino)methyl]acetamide.
| Compound Name | 2-chloro-N-[(N-(2-chloroacetyl)-2,6-diethylanilino)methyl]acetamide |
|---|---|
| PubChem CID | 154317163 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-chloro-N-[(N-(2-chloroacetyl)-2,6-diethylanilino)methyl]acetamide |
| SMILES | CCc1cccc(CC)c1N(CNC(=O)CCl)C(=O)CCl |
| InChI | InChI=1S/C15H20Cl2N2O2/c1-3-11-6-5-7-12(4-2)15(11)19(14(21)9-17)10-18-13(20)8-16/h5-7H,3-4,8-10H2,1-2H3,(H,18,20) |
| InChIKey | WDPKAIJJSCPITJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|