C17H27ClNO4P — CID 15685142
2-chloro-N-(diethoxyphosphorylmethyl)-N-(2,6-diethylphenyl)acetamide (PubChem CID 15685142) has the molecular formula C17H27ClNO4P and a molecular weight of 375.83 g/mol. Its IUPAC name is 2-chloro-N-(diethoxyphosphorylmethyl)-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-chloro-N-(diethoxyphosphorylmethyl)-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 15685142 |
| Molecular Formula | C17H27ClNO4P |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-chloro-N-(diethoxyphosphorylmethyl)-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCOP(=O)(CN(C(=O)CCl)c1c(CC)cccc1CC)OCC |
| InChI | InChI=1S/C17H27ClNO4P/c1-5-14-10-9-11-15(6-2)17(14)19(16(20)12-18)13-24(21,22-7-3)23-8-4/h9-11H,5-8,12-13H2,1-4H3 |
| InChIKey | GINDXQUJUSCIFI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|