C16H18Cl3N3O — CID 70614092
2-chloro-N-[(4,5-dichloro-1H-imidazol-2-yl)methyl]-N-(2,6-diethylphenyl)acetamide (PubChem CID 70614092) has the molecular formula C16H18Cl3N3O and a molecular weight of 374.70 g/mol. Its IUPAC name is 2-chloro-N-[(4,5-dichloro-1H-imidazol-2-yl)methyl]-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-chloro-N-[(4,5-dichloro-1H-imidazol-2-yl)methyl]-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 70614092 |
| Molecular Formula | C16H18Cl3N3O |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 2-chloro-N-[(4,5-dichloro-1H-imidazol-2-yl)methyl]-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1N(Cc1nc(Cl)c(Cl)[nH]1)C(=O)CCl |
| InChI | InChI=1S/C16H18Cl3N3O/c1-3-10-6-5-7-11(4-2)14(10)22(13(23)8-17)9-12-20-15(18)16(19)21-12/h5-7H,3-4,8-9H2,1-2H3,(H,20,21) |
| InChIKey | FVQHOSLPZXDSTK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|