C18H26ClNO3 — CID 21403978
2-chloro-N-(2,6-diethylphenyl)-N-(1,3-dioxepan-2-ylmethyl)acetamide (PubChem CID 21403978) has the molecular formula C18H26ClNO3 and a molecular weight of 339.86 g/mol. Its IUPAC name is 2-chloro-N-(2,6-diethylphenyl)-N-(1,3-dioxepan-2-ylmethyl)acetamide.
| Compound Name | 2-chloro-N-(2,6-diethylphenyl)-N-(1,3-dioxepan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 21403978 |
| Molecular Formula | C18H26ClNO3 |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-chloro-N-(2,6-diethylphenyl)-N-(1,3-dioxepan-2-ylmethyl)acetamide |
| SMILES | CCc1cccc(CC)c1N(CC1OCCCCO1)C(=O)CCl |
| InChI | InChI=1S/C18H26ClNO3/c1-3-14-8-7-9-15(4-2)18(14)20(16(21)12-19)13-17-22-10-5-6-11-23-17/h7-9,17H,3-6,10-13H2,1-2H3 |
| InChIKey | LRCYYIGNVGQQHT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|