C24H38ClNOS2 — CID 21403972
2-chloro-N-(2,6-dihexylphenyl)-N-(1,3-dithiolan-2-ylmethyl)acetamide (PubChem CID 21403972) has the molecular formula C24H38ClNOS2 and a molecular weight of 456.16 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dihexylphenyl)-N-(1,3-dithiolan-2-ylmethyl)acetamide.
| Compound Name | 2-chloro-N-(2,6-dihexylphenyl)-N-(1,3-dithiolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 21403972 |
| Molecular Formula | C24H38ClNOS2 |
| Molecular Weight | 456.16 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-chloro-N-(2,6-dihexylphenyl)-N-(1,3-dithiolan-2-ylmethyl)acetamide |
| SMILES | CCCCCCc1cccc(CCCCCC)c1N(CC1SCCS1)C(=O)CCl |
| InChI | InChI=1S/C24H38ClNOS2/c1-3-5-7-9-12-20-14-11-15-21(13-10-8-6-4-2)24(20)26(22(27)18-25)19-23-28-16-17-29-23/h11,14-15,23H,3-10,12-13,16-19H2,1-2H3 |
| InChIKey | DELRLVUFEXYJRP-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.16 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|