C18H27ClN2O2 — CID 88710767
N-(2-butoxyiminoethyl)-2-chloro-N-(2,6-diethylphenyl)acetamide (PubChem CID 88710767) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is N-(2-butoxyiminoethyl)-2-chloro-N-(2,6-diethylphenyl)acetamide.
| Compound Name | N-(2-butoxyiminoethyl)-2-chloro-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 88710767 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-(2-butoxyiminoethyl)-2-chloro-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCCCON=CCN(C(=O)CCl)c1c(CC)cccc1CC |
| InChI | InChI=1S/C18H27ClN2O2/c1-4-7-13-23-20-11-12-21(17(22)14-19)18-15(5-2)9-8-10-16(18)6-3/h8-11H,4-7,12-14H2,1-3H3 |
| InChIKey | VOMISZFNNSKHGQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|