C21H33ClN2O3 — CID 88847817
2-chloro-N-(2,6-diethyl-3-hexoxyphenyl)-N-[[(E)-ethylideneamino]oxymethyl]acetamide (PubChem CID 88847817) has the molecular formula C21H33ClN2O3 and a molecular weight of 396.96 g/mol. Its IUPAC name is 2-chloro-N-(2,6-diethyl-3-hexoxyphenyl)-N-[[(E)-ethylideneamino]oxymethyl]acetamide.
| Compound Name | 2-chloro-N-(2,6-diethyl-3-hexoxyphenyl)-N-[[(E)-ethylideneamino]oxymethyl]acetamide |
|---|---|
| PubChem CID | 88847817 |
| Molecular Formula | C21H33ClN2O3 |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-chloro-N-(2,6-diethyl-3-hexoxyphenyl)-N-[[(E)-ethylideneamino]oxymethyl]acetamide |
| SMILES | C/C=N/OCN(C(=O)CCl)c1c(CC)ccc(OCCCCCC)c1CC |
| InChI | InChI=1S/C21H33ClN2O3/c1-5-9-10-11-14-26-19-13-12-17(6-2)21(18(19)7-3)24(20(25)15-22)16-27-23-8-4/h8,12-13H,5-7,9-11,14-16H2,1-4H3/b23-8+ |
| InChIKey | ZSIBODLCXLHYQW-LIMNOBDPSA-N |
| XLogP | 5.32 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|