C15H21Cl2NO — CID 19873472
N-(2-tert-butyl-6-ethylphenyl)-2-chloro-N-(chloromethyl)acetamide (PubChem CID 19873472) has the molecular formula C15H21Cl2NO and a molecular weight of 302.25 g/mol. Its IUPAC name is N-(2-tert-butyl-6-ethylphenyl)-2-chloro-N-(chloromethyl)acetamide.
| Compound Name | N-(2-tert-butyl-6-ethylphenyl)-2-chloro-N-(chloromethyl)acetamide |
|---|---|
| PubChem CID | 19873472 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-(2-tert-butyl-6-ethylphenyl)-2-chloro-N-(chloromethyl)acetamide |
| SMILES | CCc1cccc(C(C)(C)C)c1N(CCl)C(=O)CCl |
| InChI | InChI=1S/C15H21Cl2NO/c1-5-11-7-6-8-12(15(2,3)4)14(11)18(10-17)13(19)9-16/h6-8H,5,9-10H2,1-4H3 |
| InChIKey | PULRDMISSGAJIT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|